CAS 21898-65-7 appears in our catalog under these names: 2,2,2-Trichloro-1-(1-methyl-1H-pyrrol-2-yl)ethanone 97%, 2-Trichloroacetyl-1-methylpyrrole, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethanone (CAS 21898-65-7) is a chemical compound with the molecular formula C7H6Cl3NO and a molecular weight of 226.5 g/mol. IUPAC name: 2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethanone. InChIKey: LWGNISUGCOYWRL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3NO |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethanone |
| InChIKey | LWGNISUGCOYWRL-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)