CAS 1347759-13-0 is the registry number for 1-(2,4,6-Trichloropyridin-3-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,4,6-trichloro-3-pyridinyl)ethanone (CAS 1347759-13-0) is a chemical compound with the molecular formula C7H4Cl3NO and a molecular weight of 224.5 g/mol. IUPAC name: 1-(2,4,6-trichloro-3-pyridinyl)ethanone. InChIKey: YEBBCAXAPQQICH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO |
|---|---|
| Molecular weight | 224.5 g/mol |
| IUPAC name | 1-(2,4,6-trichloro-3-pyridinyl)ethanone |
| InChIKey | YEBBCAXAPQQICH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)