Products 22241-21-0
CAS 22241-21-0 is the registry number for 2,4,6-Trichloro-benzaldehyde-oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(NE)-N-[(2,4,6-trichlorophenyl)methylidene]hydroxylamine (CAS 22241-21-0) is a chemical compound with the molecular formula C7H4Cl3NO and a molecular weight of 224.5 g/mol. IUPAC name: (NE)-N-[(2,4,6-trichlorophenyl)methylidene]hydroxylamine. InChIKey: FCBBNUOWHZWGFM-QDEBKDIKSA-N.
| Molecular formula | C7H4Cl3NO |
|---|---|
| Molecular weight | 224.5 g/mol |
| IUPAC name | (NE)-N-[(2,4,6-trichlorophenyl)methylidene]hydroxylamine |
| InChIKey | FCBBNUOWHZWGFM-QDEBKDIKSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)/C=N/O)Cl)Cl |
Computed by PubChem (NCBI)