CAS 1347815-21-7 is the registry number for Naphthalene-1,4-dithiocarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Naphthalene-1,4-dicarbothioamide (CAS 1347815-21-7) is a chemical compound with the molecular formula C12H10N2S2 and a molecular weight of 246.4 g/mol. IUPAC name: naphthalene-1,4-dicarbothioamide. InChIKey: RMVWFHNLLYPEGN-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S2 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | naphthalene-1,4-dicarbothioamide |
| InChIKey | RMVWFHNLLYPEGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=S)N)C(=S)N |
Computed by PubChem (NCBI)