CAS 851729-48-1 appears in our catalog under these names: 2–Cyanopropan–2–yl 4–cyanobenzodithioate, 2-CYANO-2-PROPYL 4-CYANOBENZODITHIOATE,&, 2-Cyanopropan-2-yl 4-cyanobenzodithioate, 98%,RG, 98%,RG, 2-Cyanopropan-2-yl 4-cyanobenzodithioate, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 250mg, 1G, 100mg.
2-cyanopropan-2-yl 4-cyanobenzenecarbodithioate (CAS 851729-48-1) is a chemical compound with the molecular formula C12H10N2S2 and a molecular weight of 246.4 g/mol. IUPAC name: 2-cyanopropan-2-yl 4-cyanobenzenecarbodithioate. InChIKey: GLQSCQVGVPUIPC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S2 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 2-cyanopropan-2-yl 4-cyanobenzenecarbodithioate |
| InChIKey | GLQSCQVGVPUIPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)SC(=S)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)