Products 1348032-93-8
CAS 1348032-93-8 appears in our catalog under these names: Sunitinib Impurity 18, Sunitinib Impurity 42. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 2g.
5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-N,N,2,4-tetramethyl-1H-pyrrole-3-carboxamide (CAS 1348032-93-8) is a chemical compound with the molecular formula C18H18FN3O2 and a molecular weight of 327.4 g/mol. IUPAC name: 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-N,N,2,4-tetramethyl-1H-pyrrole-3-carboxamide. InChIKey: JJCBMURHXKLBIV-JYRVWZFOSA-N.
| Molecular formula | C18H18FN3O2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-N,N,2,4-tetramethyl-1H-pyrrole-3-carboxamide |
| InChIKey | JJCBMURHXKLBIV-JYRVWZFOSA-N |
| SMILES | CC1=C(NC(=C1C(=O)N(C)C)C)/C=C\2/C3=C(C=CC(=C3)F)NC2=O |
Computed by PubChem (NCBI)
Synonyms:
Sunitinib Impurity 18