CAS 1707147-26-9 appears in our catalog under these names: THK5351, 98%, THK5351/ 99%, THK5351, THK5351 98%, (S)-1-Fluoro-3-((2-(6-(methylamino)pyridin-3-yl)quinolin-6-yl)oxy)propan-2-ol, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 5 mg, 25 mg.
(2S)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol (CAS 1707147-26-9) is a chemical compound with the molecular formula C18H18FN3O2 and a molecular weight of 327.4 g/mol. IUPAC name: (2S)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol. InChIKey: DLVXFZWSPCOWSN-CQSZACIVSA-N.
| Molecular formula | C18H18FN3O2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (2S)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol |
| InChIKey | DLVXFZWSPCOWSN-CQSZACIVSA-N |
| SMILES | CNC1=NC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)OC[C@@H](CF)O |
Computed by PubChem (NCBI)