CAS 134816-33-4 is the registry number for Boc-L-Phe(4-N=NPh)-OH. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenyldiazenylphenyl)propanoic acid (CAS 134816-33-4) is a chemical compound with the molecular formula C20H23N3O4 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenyldiazenylphenyl)propanoic acid. InChIKey: AGILQBLNBVSUCR-KRWDZBQOSA-N.
| Molecular formula | C20H23N3O4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenyldiazenylphenyl)propanoic acid |
| InChIKey | AGILQBLNBVSUCR-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)N=NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)