Products 19361-52-5
CAS 19361-52-5 appears in our catalog under these names: Ac-phe-tyr-nh2, 95%, Ac–Phe–Tyr–NH2, Ac-phe-tyr-nh2, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 1g.
(2S)-2-acetamido-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-phenylpropanamide (CAS 19361-52-5) is a chemical compound with the molecular formula C20H23N3O4 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-acetamido-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-phenylpropanamide. InChIKey: NRNUHNDVXOFSJO-ROUUACIJSA-N.
| Molecular formula | C20H23N3O4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-acetamido-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-phenylpropanamide |
| InChIKey | NRNUHNDVXOFSJO-ROUUACIJSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N |
Computed by PubChem (NCBI)