CAS 134818-68-1 is the registry number for 2-(1-Chlorocyclopropyl)-2-((2-chlorophenyl)methyl)oxirane. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane (CAS 134818-68-1) is a chemical compound with the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. IUPAC name: 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane. InChIKey: IKKKLHQSHUAIMM-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 2-(1-chlorocyclopropyl)-2-[(2-chlorophenyl)methyl]oxirane |
| InChIKey | IKKKLHQSHUAIMM-UHFFFAOYSA-N |
| SMILES | C1CC1(C2(CO2)CC3=CC=CC=C3Cl)Cl |
Computed by PubChem (NCBI)