CAS 71501-44-5 is the registry number for 1–(4–Chlorophenyl)cyclopentanecarbonyl chloride. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-(4-chlorophenyl)cyclopentane-1-carbonyl chloride (CAS 71501-44-5) is a chemical compound with the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carbonyl chloride. InChIKey: RZHJJILZUKNEKM-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carbonyl chloride |
| InChIKey | RZHJJILZUKNEKM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)Cl |
Computed by PubChem (NCBI)