Products 134870-46-5
CAS 134870-46-5 appears in our catalog under these names: 3-Amino-4-hydroxy-1,8-naphthalic anhydride, 95%, 3-AMINO-4-HYDROXY-1,8-NAPHTHALIC ANHYDRIDE, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg.
7-amino-8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (CAS 134870-46-5) is a chemical compound with the molecular formula C12H7NO4 and a molecular weight of 229.19 g/mol. IUPAC name: 7-amino-8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione. InChIKey: SJFVWWDXFVIHLQ-UHFFFAOYSA-N.
| Molecular formula | C12H7NO4 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 7-amino-8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| InChIKey | SJFVWWDXFVIHLQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)OC(=O)C3=CC(=C2O)N |
Computed by PubChem (NCBI)