CAS 343595-31-3 is the registry number for 7-Oxo-3,7-dihydropyrano[3,2-e]indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
7-oxo-3H-pyrano[3,2-e]indole-2-carboxylic acid (CAS 343595-31-3) is a chemical compound with the molecular formula C12H7NO4 and a molecular weight of 229.19 g/mol. IUPAC name: 7-oxo-3H-pyrano[3,2-e]indole-2-carboxylic acid. InChIKey: RFPKLZYBDZWDLD-UHFFFAOYSA-N.
| Molecular formula | C12H7NO4 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 7-oxo-3H-pyrano[3,2-e]indole-2-carboxylic acid |
| InChIKey | RFPKLZYBDZWDLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C1C3=C(C=C2)NC(=C3)C(=O)O |
Computed by PubChem (NCBI)