Products 134877-61-5
CAS 134877-61-5 is the registry number for (1R,3R,4S)-2-Azabicyclo[2.2.1]heptane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3R,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid (CAS 134877-61-5) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1R,3R,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid. InChIKey: BMVVXSIHLQYXJJ-KVQBGUIXSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1R,3R,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| InChIKey | BMVVXSIHLQYXJJ-KVQBGUIXSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@@H](N2)C(=O)O |
Computed by PubChem (NCBI)