CAS 171754-02-2 is the registry number for (1R,3S,4S)-2-Azabicyclo(2.2.1)heptane-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 10g.
(1R,3S,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid (CAS 171754-02-2) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1R,3S,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid. InChIKey: BMVVXSIHLQYXJJ-JKUQZMGJSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1R,3S,4S)-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| InChIKey | BMVVXSIHLQYXJJ-JKUQZMGJSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)