Products 134878-53-8
CAS 134878-53-8 is the registry number for 3-Fluoro-1,5-dioxaspiro(5.5)undec-3-en-2-one. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
3-fluoro-1,5-dioxaspiro[5.5]undec-2-en-4-one (CAS 134878-53-8) is a chemical compound with the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. IUPAC name: 3-fluoro-1,5-dioxaspiro[5.5]undec-2-en-4-one. InChIKey: NIHUXGYTSJGBSG-UHFFFAOYSA-N.
| Molecular formula | C9H11FO3 |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 3-fluoro-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| InChIKey | NIHUXGYTSJGBSG-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)OC=C(C(=O)O2)F |
Computed by PubChem (NCBI)