Products 502-00-1

CAS 502-00-1 is the registry number for Benzenemethanol, 4-fluoro-, acetate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Acetic acid;(4-fluorophenyl)methanol (CAS 502-00-1) is a chemical compound with the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. IUPAC name: acetic acid;(4-fluorophenyl)methanol. InChIKey: YRVJAJZVRMFCAF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11FO3
Molecular weight186.18 g/mol
IUPAC nameacetic acid;(4-fluorophenyl)methanol
InChIKeyYRVJAJZVRMFCAF-UHFFFAOYSA-N
SMILESCC(=O)O.C1=CC(=CC=C1CO)F

Computed by PubChem (NCBI)