CAS 1348988-65-7 appears in our catalog under these names: Folic acid methyl ester, Folic acid methyl ester, 99.12%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg.
(4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-methoxy-5-oxopentanoic acid (CAS 1348988-65-7) is a chemical compound with the molecular formula C20H21N7O6 and a molecular weight of 455.4 g/mol. IUPAC name: (4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-methoxy-5-oxopentanoic acid. InChIKey: YIVGBIWFBUNYLC-ZDUSSCGKSA-N.
| Molecular formula | C20H21N7O6 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (4S)-4-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-methoxy-5-oxopentanoic acid |
| InChIKey | YIVGBIWFBUNYLC-ZDUSSCGKSA-N |
| SMILES | COC(=O)[C@H](CCC(=O)O)NC(=O)C1=CC=C(C=C1)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)