Products 13492-01-8
CAS 13492-01-8 appears in our catalog under these names: (1R,2S)-rel-2-Phenylcyclopropanamine Sulfate, Tranylcypromine Sulfate, Tranylcypromine hemisulfate/ 99.94% (existing batch purity), Tranylcypromine hemisulfate (dl–Tranylcypromine hemisulfate), Tranylcypromine hemisulfate 99%. Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 100mg, 1g, 5g, 250mg, 10mg, 10mM (in 1ml water), 1mg, 100 mg.
Sulfuric acid;bis(trans-(1S,2R)-2-phenylcyclopropan-1-amine) (CAS 13492-01-8) is a chemical compound with the molecular formula C18H24N2O4S and a molecular weight of 364.5 g/mol. IUPAC name: sulfuric acid;bis(trans-(1S,2R)-2-phenylcyclopropan-1-amine). InChIKey: BKPRVQDIOGQWTG-KAVFMPKWSA-N.
| Molecular formula | C18H24N2O4S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | sulfuric acid;bis(trans-(1S,2R)-2-phenylcyclopropan-1-amine) |
| InChIKey | BKPRVQDIOGQWTG-KAVFMPKWSA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=CC=C2.C1[C@@H]([C@H]1N)C2=CC=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Tranylcypromine sulfate, Tranylcypromine sulphate, 1-Amino-2-phenylcyclopropane sulfate, Pamate, Sulfate, Tranylcypromine, (1S,2R)-2-Phenylcyclopropan-1-amine;sulfuric acid, TRANYLCYPROMINE SULFATE [MI], TRANYLCYPROMINE SULFATE [USAN], TRANYLCYPROMINE SULFATE [MART.], TRANYLCYPROMINE SULFATE [VANDF]