CAS 134947-25-4 is the registry number for (3,5-Bis(Trifluoromethyl)-1H-Pyrazol-1-Yl)Phenyl-Methanone. Offered by: Biosynth. Available pack sizes: 5g, 1g.
[3,5-bis(trifluoromethyl)pyrazol-1-yl]-phenylmethanone (CAS 134947-25-4) is a chemical compound with the molecular formula C12H6F6N2O and a molecular weight of 308.18 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)pyrazol-1-yl]-phenylmethanone. InChIKey: UESSAXBXORIGDD-UHFFFAOYSA-N.
| Molecular formula | C12H6F6N2O |
|---|---|
| Molecular weight | 308.18 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)pyrazol-1-yl]-phenylmethanone |
| InChIKey | UESSAXBXORIGDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C(=CC(=N2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)