CAS 2478991-58-9 is the registry number for JAK3-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (CAS 2478991-58-9) is a chemical compound with the molecular formula C12H6F6N2O and a molecular weight of 308.18 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide. InChIKey: PGZKKYMEBFZCMM-UHFFFAOYSA-N.
| Molecular formula | C12H6F6N2O |
|---|---|
| Molecular weight | 308.18 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| InChIKey | PGZKKYMEBFZCMM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C=C(C#N)C(=O)N |
Computed by PubChem (NCBI)