Products 1349699-85-9
CAS 1349699-85-9 appears in our catalog under these names: (S)-1-(3-Aminopyrrolidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride, 95%, (S)-1-(3-Aminopyrrolidin-1-yl)-2,2-dimethylpropan-1-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride (CAS 1349699-85-9) is a chemical compound with the molecular formula C9H19ClN2O and a molecular weight of 206.71 g/mol. IUPAC name: 1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride. InChIKey: VWIYDFCZYTWBDH-FJXQXJEOSA-N.
| Molecular formula | C9H19ClN2O |
|---|---|
| Molecular weight | 206.71 g/mol |
| IUPAC name | 1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride |
| InChIKey | VWIYDFCZYTWBDH-FJXQXJEOSA-N |
| SMILES | CC(C)(C)C(=O)N1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)