Products 1390654-88-2

CAS 1390654-88-2 is the registry number for 4-(Aminomethyl)-1-tert-butylpyrrolidin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(aminomethyl)-1-tert-butylpyrrolidin-2-one;hydrochloride (CAS 1390654-88-2) is a chemical compound with the molecular formula C9H19ClN2O and a molecular weight of 206.71 g/mol. IUPAC name: 4-(aminomethyl)-1-tert-butylpyrrolidin-2-one;hydrochloride. InChIKey: CQRNHPWTPLMIDU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19ClN2O
Molecular weight206.71 g/mol
IUPAC name4-(aminomethyl)-1-tert-butylpyrrolidin-2-one;hydrochloride
InChIKeyCQRNHPWTPLMIDU-UHFFFAOYSA-N
SMILESCC(C)(C)N1CC(CC1=O)CN.Cl

Computed by PubChem (NCBI)