Products 1349715-79-2
CAS 1349715-79-2 appears in our catalog under these names: (3–Bromobenzyl)hydrazine dihydrochloride, (3-Bromobenzyl)hydrazine dihydrochloride, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 5g, 1g.
(3-bromophenyl)methylhydrazine;dihydrochloride (CAS 1349715-79-2) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (3-bromophenyl)methylhydrazine;dihydrochloride. InChIKey: IVHLFBADYQFQDL-UHFFFAOYSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (3-bromophenyl)methylhydrazine;dihydrochloride |
| InChIKey | IVHLFBADYQFQDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CNN.Cl.Cl |
Computed by PubChem (NCBI)