CAS 1349717-27-6 is the registry number for 5-(3-(Hydroxymethyl)phenyl)thiophene-2-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-[3-(hydroxymethyl)phenyl]thiophene-2-carbonitrile (CAS 1349717-27-6) is a chemical compound with the molecular formula C12H9NOS and a molecular weight of 215.27 g/mol. IUPAC name: 5-[3-(hydroxymethyl)phenyl]thiophene-2-carbonitrile. InChIKey: DKABHGUKEGNMPP-UHFFFAOYSA-N.
| Molecular formula | C12H9NOS |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 5-[3-(hydroxymethyl)phenyl]thiophene-2-carbonitrile |
| InChIKey | DKABHGUKEGNMPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(S2)C#N)CO |
Computed by PubChem (NCBI)