CAS 189748-08-1 is the registry number for 5-(Thiophen-2-yl)indolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-thiophen-2-yl-1,3-dihydroindol-2-one (CAS 189748-08-1) is a chemical compound with the molecular formula C12H9NOS and a molecular weight of 215.27 g/mol. IUPAC name: 5-thiophen-2-yl-1,3-dihydroindol-2-one. InChIKey: RXXJBDYWKIOAPJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NOS |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 5-thiophen-2-yl-1,3-dihydroindol-2-one |
| InChIKey | RXXJBDYWKIOAPJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C3=CC=CS3)NC1=O |
Computed by PubChem (NCBI)