CAS 1349718-64-4 is the registry number for 5-Fluoro-2-((pyridin-4-yl)methoxy)aniline dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-fluoro-2-(pyridin-4-ylmethoxy)aniline;dihydrochloride (CAS 1349718-64-4) is a chemical compound with the molecular formula C12H13Cl2FN2O and a molecular weight of 291.15 g/mol. IUPAC name: 5-fluoro-2-(pyridin-4-ylmethoxy)aniline;dihydrochloride. InChIKey: RRGPGMKXHUBXEX-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2FN2O |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | 5-fluoro-2-(pyridin-4-ylmethoxy)aniline;dihydrochloride |
| InChIKey | RRGPGMKXHUBXEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)OCC2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)