CAS 2253630-28-1 is the registry number for 8-fluoro-1h,2h,3h,4h,5h,10h-benzo[b]1,6-naphthyridin-10-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
8-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one;dihydrochloride (CAS 2253630-28-1) is a chemical compound with the molecular formula C12H13Cl2FN2O and a molecular weight of 291.15 g/mol. IUPAC name: 8-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one;dihydrochloride. InChIKey: HWTUIJAVZAVKCV-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2FN2O |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | 8-fluoro-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one;dihydrochloride |
| InChIKey | HWTUIJAVZAVKCV-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C(C2=O)C=C(C=C3)F.Cl.Cl |
Computed by PubChem (NCBI)