CAS 1349903-14-5 is the registry number for 3-Bromo-5-isopropyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3-phenyl-5-propan-2-ylbenzene (CAS 1349903-14-5) is a chemical compound with the molecular formula C15H15Br and a molecular weight of 275.18 g/mol. IUPAC name: 1-bromo-3-phenyl-5-propan-2-ylbenzene. InChIKey: VIWXNWXHRKQZFQ-UHFFFAOYSA-N.
| Molecular formula | C15H15Br |
|---|---|
| Molecular weight | 275.18 g/mol |
| IUPAC name | 1-bromo-3-phenyl-5-propan-2-ylbenzene |
| InChIKey | VIWXNWXHRKQZFQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)