Products 796966-97-7
CAS 796966-97-7 is the registry number for 1-Bromo-2-(2-phenylpropan-2-yl)benzene, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-2-(2-phenylpropan-2-yl)benzene (CAS 796966-97-7) is a chemical compound with the molecular formula C15H15Br and a molecular weight of 275.18 g/mol. IUPAC name: 1-bromo-2-(2-phenylpropan-2-yl)benzene. InChIKey: CFBNYPNUPLJWQN-UHFFFAOYSA-N.
| Molecular formula | C15H15Br |
|---|---|
| Molecular weight | 275.18 g/mol |
| IUPAC name | 1-bromo-2-(2-phenylpropan-2-yl)benzene |
| InChIKey | CFBNYPNUPLJWQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)