CAS 135-11-5 is the registry number for 2-Nitro-4'-aminodiphenylamine-4-sulfonic Acid. Offered by: TRC. Available pack sizes: 250mg.
4-(4-aminoanilino)-3-nitrobenzenesulfonic acid (CAS 135-11-5) is a chemical compound with the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. IUPAC name: 4-(4-aminoanilino)-3-nitrobenzenesulfonic acid. InChIKey: IQXPRPSTZKBYER-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5S |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 4-(4-aminoanilino)-3-nitrobenzenesulfonic acid |
| InChIKey | IQXPRPSTZKBYER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=C(C=C(C=C2)S(=O)(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)