CAS 91-29-2 appears in our catalog under these names: 2-((4-aminophenyl)amino)-5-nitrobenzenesulfonic acid, 2-(N-(4-Aminophenyl))amino-5-nitrobenzenesulphonic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-(4-aminoanilino)-5-nitrobenzenesulfonic acid (CAS 91-29-2) is a chemical compound with the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. IUPAC name: 2-(4-aminoanilino)-5-nitrobenzenesulfonic acid. InChIKey: GSITZZUEHIPPMH-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5S |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 2-(4-aminoanilino)-5-nitrobenzenesulfonic acid |
| InChIKey | GSITZZUEHIPPMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)O |
Computed by PubChem (NCBI)