Products 1350443-31-0
CAS 1350443-31-0 is the registry number for 4-Bromo-3-(4-fluorophenyl)-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-bromo-3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1350443-31-0) is a chemical compound with the molecular formula C10H6BrFN2O2 and a molecular weight of 285.07 g/mol. IUPAC name: 4-bromo-3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: BEEIPVPPIIBRHW-UHFFFAOYSA-N.
| Molecular formula | C10H6BrFN2O2 |
|---|---|
| Molecular weight | 285.07 g/mol |
| IUPAC name | 4-bromo-3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | BEEIPVPPIIBRHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=C2Br)C(=O)O)F |
Computed by PubChem (NCBI)