Products 1399663-32-1

CAS 1399663-32-1 is the registry number for 5-Bromo-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-1-(4-fluorophenyl)pyrazole-4-carboxylic acid (CAS 1399663-32-1) is a chemical compound with the molecular formula C10H6BrFN2O2 and a molecular weight of 285.07 g/mol. IUPAC name: 5-bromo-1-(4-fluorophenyl)pyrazole-4-carboxylic acid. InChIKey: BZJMBGWFJPLXKI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6BrFN2O2
Molecular weight285.07 g/mol
IUPAC name5-bromo-1-(4-fluorophenyl)pyrazole-4-carboxylic acid
InChIKeyBZJMBGWFJPLXKI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C(=C(C=N2)C(=O)O)Br)F

Computed by PubChem (NCBI)