CAS 1350729-28-0 is the registry number for Rel-potassium trifluoro((1R,2R)-2-methylcyclopropyl)borate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium trifluoro-[(1R,2R)-2-methylcyclopropyl]boranuide (CAS 1350729-28-0) is a chemical compound with the molecular formula C4H7BF3K and a molecular weight of 162.01 g/mol. IUPAC name: potassium trifluoro-[(1R,2R)-2-methylcyclopropyl]boranuide. InChIKey: MLPGEOLJSZXARO-VKKIDBQXSA-N.
| Molecular formula | C4H7BF3K |
|---|---|
| Molecular weight | 162.01 g/mol |
| IUPAC name | potassium trifluoro-[(1R,2R)-2-methylcyclopropyl]boranuide |
| InChIKey | MLPGEOLJSZXARO-VKKIDBQXSA-N |
| SMILES | [B-]([C@@H]1C[C@H]1C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)