CAS 233666-81-4 is the registry number for Potassium (E)-but-2-en-1-yltrifluoroborate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Potassium [(E)-but-2-enyl]-trifluoroboranuide (CAS 233666-81-4) is a chemical compound with the molecular formula C4H7BF3K and a molecular weight of 162.01 g/mol. IUPAC name: potassium [(E)-but-2-enyl]-trifluoroboranuide. InChIKey: SIQCEUGOWYYTQR-SQQVDAMQSA-N.
| Molecular formula | C4H7BF3K |
|---|---|
| Molecular weight | 162.01 g/mol |
| IUPAC name | potassium [(E)-but-2-enyl]-trifluoroboranuide |
| InChIKey | SIQCEUGOWYYTQR-SQQVDAMQSA-N |
| SMILES | [B-](C/C=C/C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)