Products 1350748-74-1
CAS 1350748-74-1 is the registry number for N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)propionamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide (CAS 1350748-74-1) is a chemical compound with the molecular formula C13H20BN3O3 and a molecular weight of 277.13 g/mol. IUPAC name: N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide. InChIKey: UERQOMRNOORIFU-UHFFFAOYSA-N.
| Molecular formula | C13H20BN3O3 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]propanamide |
| InChIKey | UERQOMRNOORIFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC(=O)CC |
Computed by PubChem (NCBI)