Products 2246686-11-1
CAS 2246686-11-1 is the registry number for 1-Methyl-3-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-yl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea (CAS 2246686-11-1) is a chemical compound with the molecular formula C13H20BN3O3 and a molecular weight of 277.13 g/mol. IUPAC name: 1-methyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea. InChIKey: MJEPRHIGONDQIS-UHFFFAOYSA-N.
| Molecular formula | C13H20BN3O3 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | 1-methyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]urea |
| InChIKey | MJEPRHIGONDQIS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=CC(=C2)NC(=O)NC |
Computed by PubChem (NCBI)