CAS 1350769-48-0 is the registry number for (2S,6S)-2-METHYL-6-PHENYLMORPHOLINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,6S)-2-methyl-6-phenylmorpholine (CAS 1350769-48-0) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2S,6S)-2-methyl-6-phenylmorpholine. InChIKey: OEIVXYYFUJADLC-GXSJLCMTSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2S,6S)-2-methyl-6-phenylmorpholine |
| InChIKey | OEIVXYYFUJADLC-GXSJLCMTSA-N |
| SMILES | C[C@H]1CNC[C@@H](O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)