Products 1809186-11-5
CAS 1809186-11-5 is the registry number for rac-(2R,6S)-2-Methyl-6-phenylmorpholine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2R,6S)-2-methyl-6-phenylmorpholine (CAS 1809186-11-5) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2R,6S)-2-methyl-6-phenylmorpholine. InChIKey: OEIVXYYFUJADLC-MWLCHTKSSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2R,6S)-2-methyl-6-phenylmorpholine |
| InChIKey | OEIVXYYFUJADLC-MWLCHTKSSA-N |
| SMILES | C[C@@H]1CNC[C@@H](O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)