CAS 13508-96-8 appears in our catalog under these names: 2-Methyl-4-nitropyridine, 2–Methyl–4–nitropyridine, 2-Methyl-4-nitropyridine 98%, 2-Methyl-4-nitropyridine, 95%, 2-Methyl-4-nitropyridine, 98%, 98%. Offered by: TRC, GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 100g, 25g, 10g, 5g.
2-methyl-4-nitropyridine (CAS 13508-96-8) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-methyl-4-nitropyridine. InChIKey: HWPIDHRDNNZJSY-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2-methyl-4-nitropyridine |
| InChIKey | HWPIDHRDNNZJSY-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)