CAS 1350800-77-9 appears in our catalog under these names: Saxagliptin Impurity 9(BMS-700047), Saxagliptin Impurity 7, Saxagliptin Impurity 14, (1AS,4S,6aR,7aS)-4-((1r,3R,5R,7S)-3-hydroxyadamantan-1-yl)hexahydro-1H-cyclopropa[4,5]pyrrolo[1,2-a]pyrazine-3,6-dione, 98%, Saxagliptin Cyclic Amide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 15MG.
(2S,4S,6R,9S)-9-(3-hydroxy-1-adamantyl)-1,8-diazatricyclo[4.4.0.02,4]decane-7,10-dione (CAS 1350800-77-9) is a chemical compound with the molecular formula C18H24N2O3 and a molecular weight of 316.4 g/mol. IUPAC name: (2S,4S,6R,9S)-9-(3-hydroxy-1-adamantyl)-1,8-diazatricyclo[4.4.0.02,4]decane-7,10-dione. InChIKey: ZHBXKHDARSBKNT-YGADWWLDSA-N.
| Molecular formula | C18H24N2O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2S,4S,6R,9S)-9-(3-hydroxy-1-adamantyl)-1,8-diazatricyclo[4.4.0.02,4]decane-7,10-dione |
| InChIKey | ZHBXKHDARSBKNT-YGADWWLDSA-N |
| SMILES | C1[C@@H]2[C@H]1N3[C@H](C2)C(=O)N[C@H](C3=O)C45CC6CC(C4)CC(C6)(C5)O |
Computed by PubChem (NCBI)