CAS 1351452-80-6 is the registry number for NRX-204647. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-hydroxyimino-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoic acid (CAS 1351452-80-6) is a chemical compound with the molecular formula C24H27NO3 and a molecular weight of 377.5 g/mol. IUPAC name: 4-[3-hydroxyimino-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoic acid. InChIKey: DKMAOOMRQCCGEO-UHFFFAOYSA-N.
| Molecular formula | C24H27NO3 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-[3-hydroxyimino-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]benzoic acid |
| InChIKey | DKMAOOMRQCCGEO-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C(=NO)C=CC3=CC=C(C=C3)C(=O)O)(C)C)C |
Computed by PubChem (NCBI)