CAS 937604-74-5 is the registry number for 4-(4-(tert-Butyl)phenyl)-2-(7-ethylindol-3-yl)-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-tert-butylphenyl)-2-(7-ethyl-1H-indol-3-yl)-4-oxobutanoic acid (CAS 937604-74-5) is a chemical compound with the molecular formula C24H27NO3 and a molecular weight of 377.5 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-2-(7-ethyl-1H-indol-3-yl)-4-oxobutanoic acid. InChIKey: UCKVLKHHTMNVCA-UHFFFAOYSA-N.
| Molecular formula | C24H27NO3 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-2-(7-ethyl-1H-indol-3-yl)-4-oxobutanoic acid |
| InChIKey | UCKVLKHHTMNVCA-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)C(CC(=O)C3=CC=C(C=C3)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)