CAS 1351479-07-6 is the registry number for 1-(4-Bromo-2-methylphenyl)-2,2,2-trifluoroethanone. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-bromo-2-methylphenyl)-2,2,2-trifluoroethanone (CAS 1351479-07-6) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-(4-bromo-2-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: DANIINALEOHAHB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-(4-bromo-2-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | DANIINALEOHAHB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)