Products 1351630-00-6
CAS 1351630-00-6 is the registry number for (1R)-5-Chloro-2,3-dihydro-1H-inden-1-ol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(1R)-5-chloro-2,3-dihydro-1H-inden-1-ol (CAS 1351630-00-6) is a chemical compound with the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. IUPAC name: (1R)-5-chloro-2,3-dihydro-1H-inden-1-ol. InChIKey: WDXUNFVYUDYDQA-SECBINFHSA-N.
| Molecular formula | C9H9ClO |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | (1R)-5-chloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | WDXUNFVYUDYDQA-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)