CAS 1351651-87-0 is the registry number for N-(3,4-dimethoxyphenyl)guanidine methanesulfonate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,4-dimethoxyphenyl)guanidine;methanesulfonic acid (CAS 1351651-87-0) is a chemical compound with the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)guanidine;methanesulfonic acid. InChIKey: YRZONNQCOJAYMY-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O5S |
|---|---|
| Molecular weight | 291.33 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)guanidine;methanesulfonic acid |
| InChIKey | YRZONNQCOJAYMY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N=C(N)N)OC.CS(=O)(=O)O |
Computed by PubChem (NCBI)