Products 1609396-43-1

CAS 1609396-43-1 is the registry number for N-(4-Methoxybenzyl)-n-methylguanidine sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-[(4-methoxyphenyl)methyl]-1-methylguanidine;sulfuric acid (CAS 1609396-43-1) is a chemical compound with the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-1-methylguanidine;sulfuric acid. InChIKey: JZHAGALJDLEKLN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N3O5S
Molecular weight291.33 g/mol
IUPAC name1-[(4-methoxyphenyl)methyl]-1-methylguanidine;sulfuric acid
InChIKeyJZHAGALJDLEKLN-UHFFFAOYSA-N
SMILESCN(CC1=CC=C(C=C1)OC)C(=N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)