CAS 1351997-30-2 is the registry number for tert-Butyl ((1S,4S)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,4S)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (CAS 1351997-30-2) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1S,4S)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate. InChIKey: AAYQBJCHFNRLII-STQMWFEESA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1S,4S)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| InChIKey | AAYQBJCHFNRLII-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C2=CC=CC=C12)O |
Computed by PubChem (NCBI)