CAS 1352037-23-0 is the registry number for 2–propoxy–4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiazole. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1352037-23-0) is a chemical compound with the molecular formula C12H20BNO3S and a molecular weight of 269.17 g/mol. IUPAC name: 2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: ZFAOEVHAEHVSJN-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO3S |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | ZFAOEVHAEHVSJN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)OCCC |
Computed by PubChem (NCBI)